C9H8N2O2 — CID 137224680
2-aminoquinoline-5,6-diol (PubChem CID 137224680) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-aminoquinoline-5,6-diol.
| Compound Name | 2-aminoquinoline-5,6-diol |
|---|---|
| PubChem CID | 137224680 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2-aminoquinoline-5,6-diol |
| SMILES | Nc1ccc2c(O)c(O)ccc2n1 |
| InChI | InChI=1S/C9H8N2O2/c10-8-4-1-5-6(11-8)2-3-7(12)9(5)13/h1-4,12-13H,(H2,10,11) |
| InChIKey | WXTXKUWETFMBPO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|