C15H16N4O — CID 137225030
4-amino-N-(9H-pyrrolo[3,2-h]quinolin-8-yl)butanamide (PubChem CID 137225030) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-amino-N-(9H-pyrrolo[3,2-h]quinolin-8-yl)butanamide.
| Compound Name | 4-amino-N-(9H-pyrrolo[3,2-h]quinolin-8-yl)butanamide |
|---|---|
| PubChem CID | 137225030 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-amino-N-(9H-pyrrolo[3,2-h]quinolin-8-yl)butanamide |
| SMILES | NCCCC(=O)Nc1ccc2ccc3ccnc3c2[nH]1 |
| InChI | InChI=1S/C15H16N4O/c16-8-1-2-13(20)18-12-6-5-10-3-4-11-7-9-17-14(11)15(10)19-12/h3-7,9,19H,1-2,8,16H2,(H,18,20) |
| InChIKey | VMFHVFQWRMNAKY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |