C36H46N4O2 — CID 137225778
4,8-dianilino-6-(heptylamino)-2-heptylimino-5-hydroxynaphthalen-1-one (PubChem CID 137225778) has the molecular formula C36H46N4O2 and a molecular weight of 566.79 g/mol. Its IUPAC name is 4,8-dianilino-6-(heptylamino)-2-heptylimino-5-hydroxynaphthalen-1-one.
| Compound Name | 4,8-dianilino-6-(heptylamino)-2-heptylimino-5-hydroxynaphthalen-1-one |
|---|---|
| PubChem CID | 137225778 |
| Molecular Formula | C36H46N4O2 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | 4,8-dianilino-6-(heptylamino)-2-heptylimino-5-hydroxynaphthalen-1-one |
| SMILES | CCCCCCC/N=C1\C=C(Nc2ccccc2)c2c(O)c(NCCCCCCC)cc(Nc3ccccc3)c2C1=O |
| InChI | InChI=1S/C36H46N4O2/c1-3-5-7-9-17-23-37-31-25-29(39-27-19-13-11-14-20-27)34-33(35(31)41)30(40-28-21-15-12-16-22-28)26-32(36(34)42)38-24-18-10-8-6-4-2/h11-16,19-22,25-26,37,39-41H,3-10,17-18,23-24H2,1-2H3/b38-32+ |
| InChIKey | KAXPABCBOUHFBY-WAQNPYFYSA-N |
| XLogP | 9.58 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|