C20H25NO2 — CID 10968959
5-anilino-4-heptyl-3-methylcyclohexa-3,5-diene-1,2-dione (PubChem CID 10968959) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 5-anilino-4-heptyl-3-methylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 5-anilino-4-heptyl-3-methylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 10968959 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 5-anilino-4-heptyl-3-methylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCCCCC1=C(C)C(=O)C(=O)C=C1Nc1ccccc1 |
| InChI | InChI=1S/C20H25NO2/c1-3-4-5-6-10-13-17-15(2)20(23)19(22)14-18(17)21-16-11-8-7-9-12-16/h7-9,11-12,14,21H,3-6,10,13H2,1-2H3 |
| InChIKey | AQJDHLDUUDFNFZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|