C21H23N7O2S — CID 137226587
6-(4-butoxyphenyl)-4-[2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2H-tetrazol-5-yl)-1H-pyridin-2-one (PubChem CID 137226587) has the molecular formula C21H23N7O2S and a molecular weight of 437.53 g/mol. Its IUPAC name is 6-(4-butoxyphenyl)-4-[2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2H-tetrazol-5-yl)-1H-pyridin-2-one.
| Compound Name | 6-(4-butoxyphenyl)-4-[2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2H-tetrazol-5-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 137226587 |
| Molecular Formula | C21H23N7O2S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 6-(4-butoxyphenyl)-4-[2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2H-tetrazol-5-yl)-1H-pyridin-2-one |
| SMILES | CCCCOc1ccc(-c2cc(-c3cnc(N(C)C)s3)c(-c3nn[nH]n3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H23N7O2S/c1-4-5-10-30-14-8-6-13(7-9-14)16-11-15(17-12-22-21(31-17)28(2)3)18(20(29)23-16)19-24-26-27-25-19/h6-9,11-12H,4-5,10H2,1-3H3,(H,23,29)(H,24,25,26,27) |
| InChIKey | LWGVLZZXXACFKI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|