C27H31N5O2 — CID 137226641
4-[4-(dimethylamino)phenyl]-6-(4-hexoxyphenyl)-3-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one (PubChem CID 137226641) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-6-(4-hexoxyphenyl)-3-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one.
| Compound Name | 4-[4-(dimethylamino)phenyl]-6-(4-hexoxyphenyl)-3-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 137226641 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-6-(4-hexoxyphenyl)-3-(1H-1,2,4-triazol-5-yl)-1H-pyridin-2-one |
| SMILES | CCCCCCOc1ccc(-c2cc(-c3ccc(N(C)C)cc3)c(-c3ncn[nH]3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C27H31N5O2/c1-4-5-6-7-16-34-22-14-10-20(11-15-22)24-17-23(19-8-12-21(13-9-19)32(2)3)25(27(33)30-24)26-28-18-29-31-26/h8-15,17-18H,4-7,16H2,1-3H3,(H,30,33)(H,28,29,31) |
| InChIKey | WFEFHZAAGSZZSP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|