C26H30F3N5O2 — CID 144977537
N'-amino-4-[4-(dimethylamino)phenyl]-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridine-3-carboximidamide (PubChem CID 144977537) has the molecular formula C26H30F3N5O2 and a molecular weight of 501.55 g/mol. Its IUPAC name is N'-amino-4-[4-(dimethylamino)phenyl]-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridine-3-carboximidamide.
| Compound Name | N'-amino-4-[4-(dimethylamino)phenyl]-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 144977537 |
| Molecular Formula | C26H30F3N5O2 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | N'-amino-4-[4-(dimethylamino)phenyl]-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridine-3-carboximidamide |
| SMILES | CN(C)c1ccc(-c2cc(-c3ccc(OCCCCCC(F)(F)F)cc3)[nH]c(=O)c2/C(N)=N/N)cc1 |
| InChI | InChI=1S/C26H30F3N5O2/c1-34(2)19-10-6-17(7-11-19)21-16-22(32-25(35)23(21)24(30)33-31)18-8-12-20(13-9-18)36-15-5-3-4-14-26(27,28)29/h6-13,16H,3-5,14-15,31H2,1-2H3,(H2,30,33)(H,32,35) |
| InChIKey | BFUVUNKNYWSQQJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|