C24H22F6N4O2 — CID 144977540
N'-amino-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)phenyl]-1H-pyridine-3-carboximidamide (PubChem CID 144977540) has the molecular formula C24H22F6N4O2 and a molecular weight of 512.45 g/mol. Its IUPAC name is N'-amino-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)phenyl]-1H-pyridine-3-carboximidamide.
| Compound Name | N'-amino-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)phenyl]-1H-pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 144977540 |
| Molecular Formula | C24H22F6N4O2 |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | N'-amino-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)phenyl]-1H-pyridine-3-carboximidamide |
| SMILES | Cc1ccc(-c2cc(-c3ccc(OCCCC(F)(F)F)cc3C(F)(F)F)[nH]c(=O)c2/C(N)=N/N)cc1 |
| InChI | InChI=1S/C24H22F6N4O2/c1-13-3-5-14(6-4-13)17-12-19(33-22(35)20(17)21(31)34-32)16-8-7-15(11-18(16)24(28,29)30)36-10-2-9-23(25,26)27/h3-8,11-12H,2,9-10,32H2,1H3,(H2,31,34)(H,33,35) |
| InChIKey | CVUACRUIKCQANA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|