C26H27F3N6O3 — CID 144977582
ethane;N-[4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridin-3-yl]-2H-tetrazole-5-carboxamide (PubChem CID 144977582) has the molecular formula C26H27F3N6O3 and a molecular weight of 528.54 g/mol. Its IUPAC name is ethane;N-[4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridin-3-yl]-2H-tetrazole-5-carboxamide.
| Compound Name | ethane;N-[4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridin-3-yl]-2H-tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 144977582 |
| Molecular Formula | C26H27F3N6O3 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | ethane;N-[4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridin-3-yl]-2H-tetrazole-5-carboxamide |
| SMILES | CC.Cc1ccc(-c2cc(-c3ccc(OCCCC(F)(F)F)cc3)[nH]c(=O)c2NC(=O)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C24H21F3N6O3.C2H6/c1-14-3-5-15(6-4-14)18-13-19(28-22(34)20(18)29-23(35)21-30-32-33-31-21)16-7-9-17(10-8-16)36-12-2-11-24(25,26)27;1-2/h3-10,13H,2,11-12H2,1H3,(H,28,34)(H,29,35)(H,30,31,32,33);1-2H3 |
| InChIKey | BDKUQOMQJNUTBM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|