C26H32F3N5O2 — CID 144977572
N,N'-diamino-4-(3,4-dimethylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide;ethane (PubChem CID 144977572) has the molecular formula C26H32F3N5O2 and a molecular weight of 503.57 g/mol. Its IUPAC name is N,N'-diamino-4-(3,4-dimethylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide;ethane.
| Compound Name | N,N'-diamino-4-(3,4-dimethylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide;ethane |
|---|---|
| PubChem CID | 144977572 |
| Molecular Formula | C26H32F3N5O2 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | N,N'-diamino-4-(3,4-dimethylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide;ethane |
| SMILES | CC.Cc1ccc(-c2cc(-c3ccc(OCCCC(F)(F)F)cc3)[nH]c(=O)c2/C(=N/N)NN)cc1C |
| InChI | InChI=1S/C24H26F3N5O2.C2H6/c1-14-4-5-17(12-15(14)2)19-13-20(30-23(33)21(19)22(31-28)32-29)16-6-8-18(9-7-16)34-11-3-10-24(25,26)27;1-2/h4-9,12-13H,3,10-11,28-29H2,1-2H3,(H,30,33)(H,31,32);1-2H3 |
| InChIKey | NAPUMEXUIAPDQH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|