C23H24F3N5O2 — CID 137279850
N,N'-diamino-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide (PubChem CID 137279850) has the molecular formula C23H24F3N5O2 and a molecular weight of 459.47 g/mol. Its IUPAC name is N,N'-diamino-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide.
| Compound Name | N,N'-diamino-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 137279850 |
| Molecular Formula | C23H24F3N5O2 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N,N'-diamino-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide |
| SMILES | Cc1ccc(-c2cc(-c3ccc(OCCCC(F)(F)F)cc3)[nH]c(=O)c2/C(=N/N)NN)cc1 |
| InChI | InChI=1S/C23H24F3N5O2/c1-14-3-5-15(6-4-14)18-13-19(29-22(32)20(18)21(30-27)31-28)16-7-9-17(10-8-16)33-12-2-11-23(24,25)26/h3-10,13H,2,11-12,27-28H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | INOZKURZYDIMPH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|