C24H28F3N5O2S — CID 137279872
N,N'-diamino-4-(5-ethylthiophen-2-yl)-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridine-3-carboximidamide (PubChem CID 137279872) has the molecular formula C24H28F3N5O2S and a molecular weight of 507.58 g/mol. Its IUPAC name is N,N'-diamino-4-(5-ethylthiophen-2-yl)-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridine-3-carboximidamide.
| Compound Name | N,N'-diamino-4-(5-ethylthiophen-2-yl)-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 137279872 |
| Molecular Formula | C24H28F3N5O2S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | N,N'-diamino-4-(5-ethylthiophen-2-yl)-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridine-3-carboximidamide |
| SMILES | CCc1ccc(-c2cc(-c3ccc(OCCCCCC(F)(F)F)cc3)[nH]c(=O)c2/C(=N/N)NN)s1 |
| InChI | InChI=1S/C24H28F3N5O2S/c1-2-17-10-11-20(35-17)18-14-19(30-23(33)21(18)22(31-28)32-29)15-6-8-16(9-7-15)34-13-5-3-4-12-24(25,26)27/h6-11,14H,2-5,12-13,28-29H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | PWEQRDXXXCCFRI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|