C24H26F3N5O3S — CID 134332674
4-(5-ethylthiophen-2-yl)-3-(5-hydroxy-2,5-dihydrotetrazol-1-yl)-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridin-2-one (PubChem CID 134332674) has the molecular formula C24H26F3N5O3S and a molecular weight of 521.57 g/mol. Its IUPAC name is 4-(5-ethylthiophen-2-yl)-3-(5-hydroxy-2,5-dihydrotetrazol-1-yl)-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridin-2-one.
| Compound Name | 4-(5-ethylthiophen-2-yl)-3-(5-hydroxy-2,5-dihydrotetrazol-1-yl)-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134332674 |
| Molecular Formula | C24H26F3N5O3S |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 4-(5-ethylthiophen-2-yl)-3-(5-hydroxy-2,5-dihydrotetrazol-1-yl)-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridin-2-one |
| SMILES | CCc1ccc(-c2cc(-c3ccc(OCCCCCC(F)(F)F)cc3)[nH]c(=O)c2N2NN=NC2O)s1 |
| InChI | InChI=1S/C24H26F3N5O3S/c1-2-17-10-11-20(36-17)18-14-19(28-22(33)21(18)32-23(34)29-30-31-32)15-6-8-16(9-7-15)35-13-5-3-4-12-24(25,26)27/h6-11,14,23,34H,2-5,12-13H2,1H3,(H,28,33)(H,29,31) |
| InChIKey | KVZZTUWDWNHHQB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|