C23H22F4N2O5S2 — CID 129050965
4-(5-ethylthiophen-2-yl)-6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-N-methylsulfonyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 129050965) has the molecular formula C23H22F4N2O5S2 and a molecular weight of 546.56 g/mol. Its IUPAC name is 4-(5-ethylthiophen-2-yl)-6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-N-methylsulfonyl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 4-(5-ethylthiophen-2-yl)-6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-N-methylsulfonyl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129050965 |
| Molecular Formula | C23H22F4N2O5S2 |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 4-(5-ethylthiophen-2-yl)-6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-N-methylsulfonyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCc1ccc(-c2cc(-c3ccc(OCCCC(F)(F)F)cc3F)[nH]c(=O)c2C(=O)NS(C)(=O)=O)s1 |
| InChI | InChI=1S/C23H22F4N2O5S2/c1-3-14-6-8-19(35-14)16-12-18(28-21(30)20(16)22(31)29-36(2,32)33)15-7-5-13(11-17(15)24)34-10-4-9-23(25,26)27/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | XIWLDWQCWYXSTA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|