C20H20F7NO2S — CID 129050938
3-amino-1-(5-ethylthiophen-2-yl)-4,4,4-trifluoro-3-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]butan-1-one (PubChem CID 129050938) has the molecular formula C20H20F7NO2S and a molecular weight of 471.44 g/mol. Its IUPAC name is 3-amino-1-(5-ethylthiophen-2-yl)-4,4,4-trifluoro-3-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]butan-1-one.
| Compound Name | 3-amino-1-(5-ethylthiophen-2-yl)-4,4,4-trifluoro-3-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]butan-1-one |
|---|---|
| PubChem CID | 129050938 |
| Molecular Formula | C20H20F7NO2S |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 3-amino-1-(5-ethylthiophen-2-yl)-4,4,4-trifluoro-3-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]butan-1-one |
| SMILES | CCc1ccc(C(=O)CC(N)(c2ccc(OCCCC(F)(F)F)cc2F)C(F)(F)F)s1 |
| InChI | InChI=1S/C20H20F7NO2S/c1-2-13-5-7-17(31-13)16(29)11-18(28,20(25,26)27)14-6-4-12(10-15(14)21)30-9-3-8-19(22,23)24/h4-7,10H,2-3,8-9,11,28H2,1H3 |
| InChIKey | PIJUKGZISVTMEJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|