C23H22F7N5O3S — CID 129050937
N-[(2S)-4-(5-ethylthiophen-2-yl)-1,1,1-trifluoro-2-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-4-oxobutan-2-yl]-2-(2H-tetrazol-5-yl)acetamide (PubChem CID 129050937) has the molecular formula C23H22F7N5O3S and a molecular weight of 581.51 g/mol. Its IUPAC name is N-[(2S)-4-(5-ethylthiophen-2-yl)-1,1,1-trifluoro-2-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-4-oxobutan-2-yl]-2-(2H-tetrazol-5-yl)acetamide.
| Compound Name | N-[(2S)-4-(5-ethylthiophen-2-yl)-1,1,1-trifluoro-2-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-4-oxobutan-2-yl]-2-(2H-tetrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 129050937 |
| Molecular Formula | C23H22F7N5O3S |
| Molecular Weight | 581.51 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | N-[(2S)-4-(5-ethylthiophen-2-yl)-1,1,1-trifluoro-2-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-4-oxobutan-2-yl]-2-(2H-tetrazol-5-yl)acetamide |
| SMILES | CCc1ccc(C(=O)C[C@](NC(=O)Cc2nn[nH]n2)(c2ccc(OCCCC(F)(F)F)cc2F)C(F)(F)F)s1 |
| InChI | InChI=1S/C23H22F7N5O3S/c1-2-14-5-7-18(39-14)17(36)12-21(23(28,29)30,31-20(37)11-19-32-34-35-33-19)15-6-4-13(10-16(15)24)38-9-3-8-22(25,26)27/h4-7,10H,2-3,8-9,11-12H2,1H3,(H,31,37)(H,32,33,34,35)/t21-/m0/s1 |
| InChIKey | NPGMYHDORQLCHE-NRFANRHFSA-N |
| XLogP | 5.07 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|