C28H32F5N5O4 — CID 144977581
N-[(Z)-[[4-[4-(difluoromethoxy)phenyl]-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridin-3-yl]-methylamino]diazenyl]formamide;ethane (PubChem CID 144977581) has the molecular formula C28H32F5N5O4 and a molecular weight of 597.59 g/mol. Its IUPAC name is N-[(Z)-[[4-[4-(difluoromethoxy)phenyl]-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridin-3-yl]-methylamino]diazenyl]formamide;ethane.
| Compound Name | N-[(Z)-[[4-[4-(difluoromethoxy)phenyl]-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridin-3-yl]-methylamino]diazenyl]formamide;ethane |
|---|---|
| PubChem CID | 144977581 |
| Molecular Formula | C28H32F5N5O4 |
| Molecular Weight | 597.59 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | N-[(Z)-[[4-[4-(difluoromethoxy)phenyl]-2-oxo-6-[4-(6,6,6-trifluorohexoxy)phenyl]-1H-pyridin-3-yl]-methylamino]diazenyl]formamide;ethane |
| SMILES | CC.CN(/N=N\NC=O)c1c(-c2ccc(OC(F)F)cc2)cc(-c2ccc(OCCCCCC(F)(F)F)cc2)[nH]c1=O |
| InChI | InChI=1S/C26H26F5N5O4.C2H6/c1-36(35-34-32-16-37)23-21(17-5-11-20(12-6-17)40-25(27)28)15-22(33-24(23)38)18-7-9-19(10-8-18)39-14-4-2-3-13-26(29,30)31;1-2/h5-12,15-16,25H,2-4,13-14H2,1H3,(H,33,38)(H,32,35,37);1-2H3 |
| InChIKey | QAACCSVWXMZESZ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.59 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|