C25H24F8N2O4S — CID 144751973
4-[4-(difluoromethoxy)phenyl]-N-methylsulfanyl-6-oxo-2-(trifluoromethyl)-2,3-dihydro-1H-pyridine-5-carboxamide;4,4,4-trifluorobutoxybenzene (PubChem CID 144751973) has the molecular formula C25H24F8N2O4S and a molecular weight of 600.53 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-N-methylsulfanyl-6-oxo-2-(trifluoromethyl)-2,3-dihydro-1H-pyridine-5-carboxamide;4,4,4-trifluorobutoxybenzene.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-N-methylsulfanyl-6-oxo-2-(trifluoromethyl)-2,3-dihydro-1H-pyridine-5-carboxamide;4,4,4-trifluorobutoxybenzene |
|---|---|
| PubChem CID | 144751973 |
| Molecular Formula | C25H24F8N2O4S |
| Molecular Weight | 600.53 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-N-methylsulfanyl-6-oxo-2-(trifluoromethyl)-2,3-dihydro-1H-pyridine-5-carboxamide;4,4,4-trifluorobutoxybenzene |
| SMILES | CSNC(=O)C1=C(c2ccc(OC(F)F)cc2)CC(C(F)(F)F)NC1=O.FC(F)(F)CCCOc1ccccc1 |
| InChI | InChI=1S/C15H13F5N2O3S.C10H11F3O/c1-26-22-13(24)11-9(6-10(15(18,19)20)21-12(11)23)7-2-4-8(5-3-7)25-14(16)17;11-10(12,13)7-4-8-14-9-5-2-1-3-6-9/h2-5,10,14H,6H2,1H3,(H,21,23)(H,22,24);1-3,5-6H,4,7-8H2 |
| InChIKey | ADZHLJOTEMVDMU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|