C22H20F3NO4 — CID 134332833
6-oxo-4-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2,3-dihydro-1H-pyridine-5-carboxylic acid (PubChem CID 134332833) has the molecular formula C22H20F3NO4 and a molecular weight of 419.40 g/mol. Its IUPAC name is 6-oxo-4-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2,3-dihydro-1H-pyridine-5-carboxylic acid.
| Compound Name | 6-oxo-4-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2,3-dihydro-1H-pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 134332833 |
| Molecular Formula | C22H20F3NO4 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 6-oxo-4-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2,3-dihydro-1H-pyridine-5-carboxylic acid |
| SMILES | O=C(O)C1=C(c2ccccc2)CC(c2ccc(OCCCC(F)(F)F)cc2)NC1=O |
| InChI | InChI=1S/C22H20F3NO4/c23-22(24,25)11-4-12-30-16-9-7-15(8-10-16)18-13-17(14-5-2-1-3-6-14)19(21(28)29)20(27)26-18/h1-3,5-10,18H,4,11-13H2,(H,26,27)(H,28,29) |
| InChIKey | GIETUUTXHYENSK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|