C24H25F6NO3 — CID 152612932
[2-(benzylamino)-3,3,3-trifluoro-2-[4-(4,4,4-trifluorobutoxy)phenyl]propyl] cyclopropanecarboxylate (PubChem CID 152612932) has the molecular formula C24H25F6NO3 and a molecular weight of 489.46 g/mol. Its IUPAC name is [2-(benzylamino)-3,3,3-trifluoro-2-[4-(4,4,4-trifluorobutoxy)phenyl]propyl] cyclopropanecarboxylate.
| Compound Name | [2-(benzylamino)-3,3,3-trifluoro-2-[4-(4,4,4-trifluorobutoxy)phenyl]propyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 152612932 |
| Molecular Formula | C24H25F6NO3 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | [2-(benzylamino)-3,3,3-trifluoro-2-[4-(4,4,4-trifluorobutoxy)phenyl]propyl] cyclopropanecarboxylate |
| SMILES | O=C(OCC(NCc1ccccc1)(c1ccc(OCCCC(F)(F)F)cc1)C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C24H25F6NO3/c25-23(26,27)13-4-14-33-20-11-9-19(10-12-20)22(24(28,29)30,16-34-21(32)18-7-8-18)31-15-17-5-2-1-3-6-17/h1-3,5-6,9-12,18,31H,4,7-8,13-16H2 |
| InChIKey | YZXHJJBTHMDARK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|