C23H19N3O4 — CID 137230804
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(2-hydroxyethoxy)benzene-1,3-diol (PubChem CID 137230804) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(2-hydroxyethoxy)benzene-1,3-diol.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(2-hydroxyethoxy)benzene-1,3-diol |
|---|---|
| PubChem CID | 137230804 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(2-hydroxyethoxy)benzene-1,3-diol |
| SMILES | OCCOc1cc(O)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(O)c1 |
| InChI | InChI=1S/C23H19N3O4/c27-11-12-30-17-13-18(28)20(19(29)14-17)23-25-21(15-7-3-1-4-8-15)24-22(26-23)16-9-5-2-6-10-16/h1-10,13-14,27-29H,11-12H2 |
| InChIKey | BHWFRZNGYXRGML-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |