C30H23N3O5 — CID 137201033
2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,5-dihydroxyphenoxy]ethyl benzoate (PubChem CID 137201033) has the molecular formula C30H23N3O5 and a molecular weight of 505.53 g/mol. Its IUPAC name is 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,5-dihydroxyphenoxy]ethyl benzoate.
| Compound Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,5-dihydroxyphenoxy]ethyl benzoate |
|---|---|
| PubChem CID | 137201033 |
| Molecular Formula | C30H23N3O5 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,5-dihydroxyphenoxy]ethyl benzoate |
| SMILES | O=C(OCCOc1cc(O)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C30H23N3O5/c34-24-18-23(37-16-17-38-30(36)22-14-8-3-9-15-22)19-25(35)26(24)29-32-27(20-10-4-1-5-11-20)31-28(33-29)21-12-6-2-7-13-21/h1-15,18-19,34-35H,16-17H2 |
| InChIKey | RUURDJJMNPKNQF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|