C8H15N5O — CID 137231146
4-(1,1,2,2,2-pentadeuterioethylamino)-6-(propan-2-ylamino)-1H-1,3,5-triazin-2-one (PubChem CID 137231146) has the molecular formula C8H15N5O and a molecular weight of 202.27 g/mol. Its IUPAC name is 4-(1,1,2,2,2-pentadeuterioethylamino)-6-(propan-2-ylamino)-1H-1,3,5-triazin-2-one.
| Compound Name | 4-(1,1,2,2,2-pentadeuterioethylamino)-6-(propan-2-ylamino)-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 137231146 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 4-(1,1,2,2,2-pentadeuterioethylamino)-6-(propan-2-ylamino)-1H-1,3,5-triazin-2-one |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])Nc1nc(NC(C)C)[nH]c(=O)n1 |
| InChI | InChI=1S/C8H15N5O/c1-4-9-6-11-7(10-5(2)3)13-8(14)12-6/h5H,4H2,1-3H3,(H3,9,10,11,12,13,14)/i1D3,4D2 |
| InChIKey | NFMIMWNQWAWNDW-SGEUAGPISA-N |
| XLogP | 0.42 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |