C19H15N3O4 — CID 137260309
3-nitro-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)benzamide (PubChem CID 137260309) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 3-nitro-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)benzamide.
| Compound Name | 3-nitro-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)benzamide |
|---|---|
| PubChem CID | 137260309 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-nitro-N-(4-oxo-2,3,5,9a-tetrahydro-1H-cyclopenta[c]quinolin-7-ylidene)benzamide |
| SMILES | O=C1NC2=C/C(=N/C(=O)c3cccc([N+](=O)[O-])c3)C=CC2C2=C1CCC2 |
| InChI | InChI=1S/C19H15N3O4/c23-18(11-3-1-4-13(9-11)22(25)26)20-12-7-8-15-14-5-2-6-16(14)19(24)21-17(15)10-12/h1,3-4,7-10,15H,2,5-6H2,(H,21,24)/b20-12+ |
| InChIKey | AMYNUSOSAUFQJH-UDWIEESQSA-N |
| XLogP | 2.86 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|