C22H22N6O — CID 137263216
4-ethyl-2-[6-[[4-(imidazol-1-ylmethyl)phenyl]methylamino]-3-pyridinyl]-1H-pyrimidin-6-one (PubChem CID 137263216) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-ethyl-2-[6-[[4-(imidazol-1-ylmethyl)phenyl]methylamino]-3-pyridinyl]-1H-pyrimidin-6-one.
| Compound Name | 4-ethyl-2-[6-[[4-(imidazol-1-ylmethyl)phenyl]methylamino]-3-pyridinyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137263216 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-ethyl-2-[6-[[4-(imidazol-1-ylmethyl)phenyl]methylamino]-3-pyridinyl]-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(-c2ccc(NCc3ccc(Cn4ccnc4)cc3)nc2)n1 |
| InChI | InChI=1S/C22H22N6O/c1-2-19-11-21(29)27-22(26-19)18-7-8-20(25-13-18)24-12-16-3-5-17(6-4-16)14-28-10-9-23-15-28/h3-11,13,15H,2,12,14H2,1H3,(H,24,25)(H,26,27,29) |
| InChIKey | ROXMGKRLSMQDJT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |