C72H63N4+ — CID 137270162
CID 137270162 (PubChem CID 137270162) has the molecular formula C72H63N4+ and a molecular weight of 984.32 g/mol.
| Compound Name | CID 137270162 |
|---|---|
| PubChem CID | 137270162 |
| Molecular Formula | C72H63N4+ |
| Molecular Weight | 984.32 g/mol |
| Exact Mass | 983.50 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c2cc(/C3=C(\c4cc5c(C)cc(C)cc(C)c-5c4)C4=N/C(=c5/cc/c([nH]5)=C(c5cc6c(C)cc(C)cc(C)c-6c5)/C(c5cc6c(C)cc(C)cc(C)c-6c5)=c5/cc/c([nH]5)=C5\[CH+]C=C3N5)C=C4)cc-2c(C)c1 |
| InChI | InChI=1S/C72H63N4/c1-37-21-41(5)53-29-49(30-54(53)42(6)22-37)69-65-17-13-61(73-65)62-15-19-67(75-62)71(51-33-57-45(9)25-39(3)26-46(10)58(57)34-51)72(52-35-59-47(11)27-40(4)28-48(12)60(59)36-52)68-20-16-64(76-68)63-14-18-66(74-63)70(69)50-31-55-43(7)23-38(2)24-44(8)56(55)32-50/h13-36,73-75H,1-12H3/q+1/b62-61-,64-63-,69-65-,70-66-,72-71- |
| InChIKey | BDGBVCMGDOCTKO-GPCPGPGJSA-N |
| XLogP | 14.10 |
| TPSA | 55.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.32 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|