C52H64N6O4 — CID 137274156
10,20-bis[3,5-bis(3-methylbutoxy)phenyl]-21,23-dihydroporphyrin-5,15-diamine (PubChem CID 137274156) has the molecular formula C52H64N6O4 and a molecular weight of 837.12 g/mol. Its IUPAC name is 10,20-bis[3,5-bis(3-methylbutoxy)phenyl]-21,23-dihydroporphyrin-5,15-diamine.
| Compound Name | 10,20-bis[3,5-bis(3-methylbutoxy)phenyl]-21,23-dihydroporphyrin-5,15-diamine |
|---|---|
| PubChem CID | 137274156 |
| Molecular Formula | C52H64N6O4 |
| Molecular Weight | 837.12 g/mol |
| Exact Mass | 836.50 |
| IUPAC Name | 10,20-bis[3,5-bis(3-methylbutoxy)phenyl]-21,23-dihydroporphyrin-5,15-diamine |
| SMILES | CC(C)CCOc1cc(OCCC(C)C)cc(-c2c3nc(c(N)c4ccc([nH]4)c(-c4cc(OCCC(C)C)cc(OCCC(C)C)c4)c4nc(c(N)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C52H64N6O4/c1-31(2)17-21-59-37-25-35(26-38(29-37)60-22-18-32(3)4)49-41-9-13-45(55-41)51(53)47-15-11-43(57-47)50(44-12-16-48(58-44)52(54)46-14-10-42(49)56-46)36-27-39(61-23-19-33(5)6)30-40(28-36)62-24-20-34(7)8/h9-16,25-34,55,58H,17-24,53-54H2,1-8H3/b49-41-,49-42-,50-43-,50-44-,51-45+,51-47+,52-46+,52-48+ |
| InChIKey | DFVJZLBLMHPGDW-JZLVAWSNSA-N |
| XLogP | 12.85 |
| TPSA | 146.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.12 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |