C9H12N4O2 — CID 137274391
2-N'-benzyl-1-N',2-N-dihydroxyethanediimidamide (PubChem CID 137274391) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-N'-benzyl-1-N',2-N-dihydroxyethanediimidamide.
| Compound Name | 2-N'-benzyl-1-N',2-N-dihydroxyethanediimidamide |
|---|---|
| PubChem CID | 137274391 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-N'-benzyl-1-N',2-N-dihydroxyethanediimidamide |
| SMILES | NC(=N/O)/C(=N/Cc1ccccc1)NO |
| InChI | InChI=1S/C9H12N4O2/c10-8(12-14)9(13-15)11-6-7-4-2-1-3-5-7/h1-5,14-15H,6H2,(H2,10,12)(H,11,13) |
| InChIKey | YARADZRGKYTLBS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|