C9H8ClN5O — CID 137279213
5-amino-4-[(2-chlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one (PubChem CID 137279213) has the molecular formula C9H8ClN5O and a molecular weight of 237.65 g/mol. Its IUPAC name is 5-amino-4-[(2-chlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-amino-4-[(2-chlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 137279213 |
| Molecular Formula | C9H8ClN5O |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 5-amino-4-[(2-chlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one |
| SMILES | Nc1[nH][nH]c(=O)c1/N=N/c1ccccc1Cl |
| InChI | InChI=1S/C9H8ClN5O/c10-5-3-1-2-4-6(5)12-13-7-8(11)14-15-9(7)16/h1-4H,(H4,11,14,15,16)/b13-12+ |
| InChIKey | OQCBZGQPSXIOJI-OUKQBFOZSA-N |
| XLogP | 2.35 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|