C8H16N6O3S — CID 137287419
5-(diethylsulfamoylamino)-N'-hydroxy-1H-pyrazole-4-carboximidamide (PubChem CID 137287419) has the molecular formula C8H16N6O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 5-(diethylsulfamoylamino)-N'-hydroxy-1H-pyrazole-4-carboximidamide.
| Compound Name | 5-(diethylsulfamoylamino)-N'-hydroxy-1H-pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 137287419 |
| Molecular Formula | C8H16N6O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-(diethylsulfamoylamino)-N'-hydroxy-1H-pyrazole-4-carboximidamide |
| SMILES | CCN(CC)S(=O)(=O)Nc1[nH]ncc1/C(N)=N/O |
| InChI | InChI=1S/C8H16N6O3S/c1-3-14(4-2)18(16,17)13-8-6(5-10-11-8)7(9)12-15/h5,15H,3-4H2,1-2H3,(H2,9,12)(H2,10,11,13) |
| InChIKey | NWENKGJJNWLLNH-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|