C16H17N — CID 137287643
3-(1-cyclopenta-1,4-dien-1-ylethyl)-4-methyl-1H-indole (PubChem CID 137287643) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-(1-cyclopenta-1,4-dien-1-ylethyl)-4-methyl-1H-indole.
| Compound Name | 3-(1-cyclopenta-1,4-dien-1-ylethyl)-4-methyl-1H-indole |
|---|---|
| PubChem CID | 137287643 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-(1-cyclopenta-1,4-dien-1-ylethyl)-4-methyl-1H-indole |
| SMILES | Cc1cccc2[nH]cc(C(C)C3=CCC=C3)c12 |
| InChI | InChI=1S/C16H17N/c1-11-6-5-9-15-16(11)14(10-17-15)12(2)13-7-3-4-8-13/h3,5-10,12,17H,4H2,1-2H3 |
| InChIKey | YBCWAOUQBDVXKG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |