C62H64N4O2S — CID 137287738
2,6-ditert-butyl-4-[4-(3,5-ditert-butyl-4-hydroxyphenyl)-2,5-bis(4,5-diphenyl-1H-imidazol-2-yl)thiophen-3-yl]phenol (PubChem CID 137287738) has the molecular formula C62H64N4O2S and a molecular weight of 929.29 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[4-(3,5-ditert-butyl-4-hydroxyphenyl)-2,5-bis(4,5-diphenyl-1H-imidazol-2-yl)thiophen-3-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[4-(3,5-ditert-butyl-4-hydroxyphenyl)-2,5-bis(4,5-diphenyl-1H-imidazol-2-yl)thiophen-3-yl]phenol |
|---|---|
| PubChem CID | 137287738 |
| Molecular Formula | C62H64N4O2S |
| Molecular Weight | 929.29 g/mol |
| Exact Mass | 928.47 |
| IUPAC Name | 2,6-ditert-butyl-4-[4-(3,5-ditert-butyl-4-hydroxyphenyl)-2,5-bis(4,5-diphenyl-1H-imidazol-2-yl)thiophen-3-yl]phenol |
| SMILES | CC(C)(C)c1cc(-c2c(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)sc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)c2-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C62H64N4O2S/c1-59(2,3)43-33-41(34-44(53(43)67)60(4,5)6)47-48(42-35-45(61(7,8)9)54(68)46(36-42)62(10,11)12)56(58-65-51(39-29-21-15-22-30-39)52(66-58)40-31-23-16-24-32-40)69-55(47)57-63-49(37-25-17-13-18-26-37)50(64-57)38-27-19-14-20-28-38/h13-36,67-68H,1-12H3,(H,63,64)(H,65,66) |
| InChIKey | AJZWSGPGXSZICF-UHFFFAOYSA-N |
| XLogP | 17.13 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.29 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|