C27H22ClN5O3S — CID 137314817
2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-1,3-thiazole-4-carboxamide (PubChem CID 137314817) has the molecular formula C27H22ClN5O3S and a molecular weight of 532.03 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 137314817 |
| Molecular Formula | C27H22ClN5O3S |
| Molecular Weight | 532.03 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-1,3-thiazole-4-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2csc(N3N=C(c4ccccc4)CC3c3ccc(Cl)cc3)n2)ccc1O |
| InChI | InChI=1S/C27H22ClN5O3S/c1-36-25-13-17(7-12-24(25)34)15-29-31-26(35)22-16-37-27(30-22)33-23(19-8-10-20(28)11-9-19)14-21(32-33)18-5-3-2-4-6-18/h2-13,15-16,23,34H,14H2,1H3,(H,31,35)/b29-15+ |
| InChIKey | AKHMMBQILYPVFY-WKULSOCRSA-N |
| XLogP | 5.63 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.03 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|