C19H21F2N5O2S — CID 137315657
4-[3-fluoro-5-(2-hydroxyethyl)-2-pyridinyl]-N-[(4-fluoro-2-sulfanylphenyl)iminomethyl]piperazine-1-carboxamide (PubChem CID 137315657) has the molecular formula C19H21F2N5O2S and a molecular weight of 421.47 g/mol. Its IUPAC name is 4-[3-fluoro-5-(2-hydroxyethyl)-2-pyridinyl]-N-[(4-fluoro-2-sulfanylphenyl)iminomethyl]piperazine-1-carboxamide.
| Compound Name | 4-[3-fluoro-5-(2-hydroxyethyl)-2-pyridinyl]-N-[(4-fluoro-2-sulfanylphenyl)iminomethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 137315657 |
| Molecular Formula | C19H21F2N5O2S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 4-[3-fluoro-5-(2-hydroxyethyl)-2-pyridinyl]-N-[(4-fluoro-2-sulfanylphenyl)iminomethyl]piperazine-1-carboxamide |
| SMILES | O=C(N/C=N/c1ccc(F)cc1S)N1CCN(c2ncc(CCO)cc2F)CC1 |
| InChI | InChI=1S/C19H21F2N5O2S/c20-14-1-2-16(17(29)10-14)23-12-24-19(28)26-6-4-25(5-7-26)18-15(21)9-13(3-8-27)11-22-18/h1-2,9-12,27,29H,3-8H2,(H,23,24,28) |
| InChIKey | MQIGEJYFDVDCNC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|