C13H11N5O4S — CID 137326547
5,7-dimethyl-3-(4-nitroanilino)-6-sulfanylidene-[1,2]oxazolo[5,4-d]pyrimidin-4-one (PubChem CID 137326547) has the molecular formula C13H11N5O4S and a molecular weight of 333.33 g/mol. Its IUPAC name is 5,7-dimethyl-3-(4-nitroanilino)-6-sulfanylidene-[1,2]oxazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5,7-dimethyl-3-(4-nitroanilino)-6-sulfanylidene-[1,2]oxazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137326547 |
| Molecular Formula | C13H11N5O4S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 5,7-dimethyl-3-(4-nitroanilino)-6-sulfanylidene-[1,2]oxazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cn1c(=O)c2c(Nc3ccc([N+](=O)[O-])cc3)noc2n(C)c1=S |
| InChI | InChI=1S/C13H11N5O4S/c1-16-11(19)9-10(15-22-12(9)17(2)13(16)23)14-7-3-5-8(6-4-7)18(20)21/h3-6H,1-2H3,(H,14,15) |
| InChIKey | ZUSLKNGYRPUHAS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|