C20H19N5O5 — CID 139230103
3-(4-methoxyanilino)-4,6-dimethyl-7-(4-nitrophenyl)-7H-[1,2]oxazolo[4,3-d]pyrimidin-5-one (PubChem CID 139230103) has the molecular formula C20H19N5O5 and a molecular weight of 409.40 g/mol. Its IUPAC name is 3-(4-methoxyanilino)-4,6-dimethyl-7-(4-nitrophenyl)-7H-[1,2]oxazolo[4,3-d]pyrimidin-5-one.
| Compound Name | 3-(4-methoxyanilino)-4,6-dimethyl-7-(4-nitrophenyl)-7H-[1,2]oxazolo[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 139230103 |
| Molecular Formula | C20H19N5O5 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 3-(4-methoxyanilino)-4,6-dimethyl-7-(4-nitrophenyl)-7H-[1,2]oxazolo[4,3-d]pyrimidin-5-one |
| SMILES | COc1ccc(Nc2onc3c2N(C)C(=O)N(C)C3c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H19N5O5/c1-23-17(12-4-8-14(9-5-12)25(27)28)16-18(24(2)20(23)26)19(30-22-16)21-13-6-10-15(29-3)11-7-13/h4-11,17,21H,1-3H3 |
| InChIKey | URPQOSCBZKFCNF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|