About hexa-2,3,4,5-tetraenoic acid
hexa-2,3,4,5-tetraenoic acid (PubChem CID 137332363) has the molecular formula C6H4O2
and a molecular weight of 108.10 g/mol. Its IUPAC name is hexa-2,3,4,5-tetraenoic acid.
Molecular Properties
| Compound Name | hexa-2,3,4,5-tetraenoic acid |
| PubChem CID | 137332363 |
| Molecular Formula | C6H4O2 |
| Molecular Weight | 108.10 g/mol |
| Exact Mass | 108.02 |
| IUPAC Name | hexa-2,3,4,5-tetraenoic acid |
| SMILES | C=C=C=C=CC(=O)O |
| InChI | InChI=1S/C6H4O2/c1-2-3-4-5-6(7)8/h5H,1H2,(H,7,8) |
| InChIKey | FOLOKYVQNJLFFX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.10 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hexa-2,3,4,5-tetraenoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-2,3,4,5-tetraenoic acid?
The IUPAC name of hexa-2,3,4,5-tetraenoic acid (CID 137332363) is hexa-2,3,4,5-tetraenoic acid.
What is the SMILES notation for hexa-2,3,4,5-tetraenoic acid?
The canonical SMILES for hexa-2,3,4,5-tetraenoic acid is C=C=C=C=CC(=O)O.
What is the InChIKey of hexa-2,3,4,5-tetraenoic acid?
The InChIKey is FOLOKYVQNJLFFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2/c1-2-3-4-5-6(7)8/h5H,1H2,(H,7,8).
What are the key properties of hexa-2,3,4,5-tetraenoic acid?
hexa-2,3,4,5-tetraenoic acid has a molecular weight of 108.10 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-2,3,4,5-tetraenoic acid is sourced from PubChem (CID 137332363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).