C19H25F2N3O — CID 137344578
(3R,8aR)-2-[1-(3,4-difluorophenyl)piperidin-4-yl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137344578) has the molecular formula C19H25F2N3O and a molecular weight of 349.43 g/mol. Its IUPAC name is (3R,8aR)-2-[1-(3,4-difluorophenyl)piperidin-4-yl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3R,8aR)-2-[1-(3,4-difluorophenyl)piperidin-4-yl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137344578 |
| Molecular Formula | C19H25F2N3O |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (3R,8aR)-2-[1-(3,4-difluorophenyl)piperidin-4-yl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | C[C@@H]1C(=O)N2CCC[C@@H]2CN1C1CCN(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H25F2N3O/c1-13-19(25)23-8-2-3-16(23)12-24(13)14-6-9-22(10-7-14)15-4-5-17(20)18(21)11-15/h4-5,11,13-14,16H,2-3,6-10,12H2,1H3/t13-,16-/m1/s1 |
| InChIKey | HHHZJTWNQJZZJN-CZUORRHYSA-N |
| XLogP | 2.63 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |