C11H23N2O9P — CID 137349674
(2S)-2-amino-6-[[(3R,4R)-3,4-dihydroxy-2-oxo-5-phosphonooxypentyl]amino]hexanoic acid (PubChem CID 137349674) has the molecular formula C11H23N2O9P and a molecular weight of 358.28 g/mol. Its IUPAC name is (2S)-2-amino-6-[[(3R,4R)-3,4-dihydroxy-2-oxo-5-phosphonooxypentyl]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[(3R,4R)-3,4-dihydroxy-2-oxo-5-phosphonooxypentyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 137349674 |
| Molecular Formula | C11H23N2O9P |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (2S)-2-amino-6-[[(3R,4R)-3,4-dihydroxy-2-oxo-5-phosphonooxypentyl]amino]hexanoic acid |
| SMILES | N[C@@H](CCCCNCC(=O)[C@H](O)[C@H](O)COP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C11H23N2O9P/c12-7(11(17)18)3-1-2-4-13-5-8(14)10(16)9(15)6-22-23(19,20)21/h7,9-10,13,15-16H,1-6,12H2,(H,17,18)(H2,19,20,21)/t7-,9+,10-/m0/s1 |
| InChIKey | FCAUVIWDSGPTCC-SFGNSQDASA-N |
| XLogP | -2.44 |
| TPSA | 199.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|