C15H27N6O7PS — CID 137349758
[(2R,3S,4R,5R)-5-(6-amino-1,4-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2S)-2-amino-4-methylsulfanylbutyl] hydrogen phosphate (PubChem CID 137349758) has the molecular formula C15H27N6O7PS and a molecular weight of 466.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-amino-1,4-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2S)-2-amino-4-methylsulfanylbutyl] hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-amino-1,4-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2S)-2-amino-4-methylsulfanylbutyl] hydrogen phosphate |
|---|---|
| PubChem CID | 137349758 |
| Molecular Formula | C15H27N6O7PS |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-1,4-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2S)-2-amino-4-methylsulfanylbutyl] hydrogen phosphate |
| SMILES | CSCC[C@H](N)COP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C(N)NC=NC32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H27N6O7PS/c1-30-3-2-8(16)4-26-29(24,25)27-5-9-11(22)12(23)15(28-9)21-7-20-10-13(17)18-6-19-14(10)21/h6-9,11-12,14-15,22-23H,2-5,16-17H2,1H3,(H,18,19)(H,24,25)/t8-,9+,11+,12+,14?,15+/m0/s1 |
| InChIKey | GJUQRKWTINGHCW-LLTXIYJVSA-N |
| XLogP | -1.92 |
| TPSA | 197.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|