C16H25N5O4 — CID 18646883
(2R,3R,4S,5R)-2-(6-amino-1,4-dihydropurin-9-yl)-5-(cyclohexyloxymethyl)oxolane-3,4-diol (PubChem CID 18646883) has the molecular formula C16H25N5O4 and a molecular weight of 351.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-1,4-dihydropurin-9-yl)-5-(cyclohexyloxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-1,4-dihydropurin-9-yl)-5-(cyclohexyloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 18646883 |
| Molecular Formula | C16H25N5O4 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-1,4-dihydropurin-9-yl)-5-(cyclohexyloxymethyl)oxolane-3,4-diol |
| SMILES | NC1=C2N=CN([C@@H]3O[C@H](COC4CCCCC4)[C@@H](O)[C@H]3O)C2N=CN1 |
| InChI | InChI=1S/C16H25N5O4/c17-14-11-15(19-7-18-14)21(8-20-11)16-13(23)12(22)10(25-16)6-24-9-4-2-1-3-5-9/h7-10,12-13,15-16,22-23H,1-6,17H2,(H,18,19)/t10-,12-,13-,15?,16-/m1/s1 |
| InChIKey | CTIHPZXNXMLMEM-MIWZLHRFSA-N |
| XLogP | -0.79 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |