C10H16N5O9P2+ — CID 173231731
[(2R,3S,4R,5R)-5-(6-amino-3-phosphono-4H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium (PubChem CID 173231731) has the molecular formula C10H16N5O9P2+ and a molecular weight of 412.21 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-amino-3-phosphono-4H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S,4R,5R)-5-(6-amino-3-phosphono-4H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 173231731 |
| Molecular Formula | C10H16N5O9P2+ |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-3-phosphono-4H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium |
| SMILES | NC1=C2N=CN([C@@H]3O[C@H](CO[P+](=O)O)[C@@H](O)[C@H]3O)C2N(P(=O)(O)O)C=N1 |
| InChI | InChI=1S/C10H15N5O9P2/c11-8-5-9(15(3-13-8)26(20,21)22)14(2-12-5)10-7(17)6(16)4(24-10)1-23-25(18)19/h2-4,6-7,9-10,16-17H,1,11H2,(H2-,18,19,20,21,22)/p+1/t4-,6-,7-,9?,10-/m1/s1 |
| InChIKey | JPHGHIUOLMYLRB-AFPKLJJXSA-O |
| XLogP | -2.67 |
| TPSA | 210.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|