C10H16N5O4P — CID 155282484
(2R,5R)-2-(6-amino-1,4-dihydropurin-9-yl)-5-(phosphanyloxymethyl)oxolane-3,4-diol (PubChem CID 155282484) has the molecular formula C10H16N5O4P and a molecular weight of 301.24 g/mol. Its IUPAC name is (2R,5R)-2-(6-amino-1,4-dihydropurin-9-yl)-5-(phosphanyloxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(6-amino-1,4-dihydropurin-9-yl)-5-(phosphanyloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 155282484 |
| Molecular Formula | C10H16N5O4P |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (2R,5R)-2-(6-amino-1,4-dihydropurin-9-yl)-5-(phosphanyloxymethyl)oxolane-3,4-diol |
| SMILES | NC1=C2N=CN([C@@H]3O[C@H](COP)C(O)C3O)C2N=CN1 |
| InChI | InChI=1S/C10H16N5O4P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(19-10)1-18-20/h2-4,6-7,9-10,16-17H,1,11,20H2,(H,12,13)/t4-,6?,7?,9?,10-/m1/s1 |
| InChIKey | MSVQUDXNYRULJI-JGUFVVNASA-N |
| XLogP | -2.33 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|