C37H53N — CID 137380869
(5Z)-2,3,4-trimethyl-5-[(2E,4E,6E,8Z,10E,13Z,15Z)-3,4,8,9-tetraethyl-2,5,7,10-tetramethyl-12-methylideneheptadeca-2,4,6,8,10,13,15-heptaenylidene]pyrrole (PubChem CID 137380869) has the molecular formula C37H53N and a molecular weight of 511.84 g/mol. Its IUPAC name is (5Z)-2,3,4-trimethyl-5-[(2E,4E,6E,8Z,10E,13Z,15Z)-3,4,8,9-tetraethyl-2,5,7,10-tetramethyl-12-methylideneheptadeca-2,4,6,8,10,13,15-heptaenylidene]pyrrole.
| Compound Name | (5Z)-2,3,4-trimethyl-5-[(2E,4E,6E,8Z,10E,13Z,15Z)-3,4,8,9-tetraethyl-2,5,7,10-tetramethyl-12-methylideneheptadeca-2,4,6,8,10,13,15-heptaenylidene]pyrrole |
|---|---|
| PubChem CID | 137380869 |
| Molecular Formula | C37H53N |
| Molecular Weight | 511.84 g/mol |
| Exact Mass | 511.42 |
| IUPAC Name | (5Z)-2,3,4-trimethyl-5-[(2E,4E,6E,8Z,10E,13Z,15Z)-3,4,8,9-tetraethyl-2,5,7,10-tetramethyl-12-methylideneheptadeca-2,4,6,8,10,13,15-heptaenylidene]pyrrole |
| SMILES | C=C(/C=C\C=C/C)/C=C(C)/C(CC)=C(CC)\C(C)=C\C(C)=C(CC)\C(CC)=C(C)\C=C1/N=C(C)C(C)=C1C |
| InChI | InChI=1S/C37H53N/c1-14-19-20-21-25(6)22-26(7)33(15-2)34(16-3)27(8)23-28(9)35(17-4)36(18-5)29(10)24-37-31(12)30(11)32(13)38-37/h14,19-24H,6,15-18H2,1-5,7-13H3/b19-14-,21-20-,26-22+,27-23+,34-33-,35-28+,36-29+,37-24- |
| InChIKey | ACSHRCPQUGPJLM-STNQAHTRSA-N |
| XLogP | 11.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.84 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|