C24H31FN2O — CID 137435860
(1R,7R)-7-(2-fluoroethyl)-N-(4-iminocyclohexyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide (PubChem CID 137435860) has the molecular formula C24H31FN2O and a molecular weight of 382.52 g/mol. Its IUPAC name is (1R,7R)-7-(2-fluoroethyl)-N-(4-iminocyclohexyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide.
| Compound Name | (1R,7R)-7-(2-fluoroethyl)-N-(4-iminocyclohexyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide |
|---|---|
| PubChem CID | 137435860 |
| Molecular Formula | C24H31FN2O |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (1R,7R)-7-(2-fluoroethyl)-N-(4-iminocyclohexyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide |
| SMILES | [H]N=C1CCC(NC(=O)C23CC4C[C@](c5ccccc5)(C2)C[C@@]3(CCF)C4)CC1 |
| InChI | InChI=1S/C24H31FN2O/c25-11-10-23-13-17-12-22(15-23,18-4-2-1-3-5-18)16-24(23,14-17)21(28)27-20-8-6-19(26)7-9-20/h1-5,17,20,26H,6-16H2,(H,27,28)/b26-19-/t17?,20?,22-,23-,24?/m1/s1 |
| InChIKey | UEUSHPBKPFYYBZ-CSFVDEGSSA-N |
| XLogP | 4.94 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|