C23H31ClN2O2 — CID 137436151
(1R,7R)-7-(2-chloroethyl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide (PubChem CID 137436151) has the molecular formula C23H31ClN2O2 and a molecular weight of 402.97 g/mol. Its IUPAC name is (1R,7R)-7-(2-chloroethyl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide.
| Compound Name | (1R,7R)-7-(2-chloroethyl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide |
|---|---|
| PubChem CID | 137436151 |
| Molecular Formula | C23H31ClN2O2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (1R,7R)-7-(2-chloroethyl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCNC[C@H]1O)C12CC3C[C@](c4ccccc4)(C1)C[C@@]2(CCCl)C3 |
| InChI | InChI=1S/C23H31ClN2O2/c24-8-7-22-11-16-10-21(14-22,17-4-2-1-3-5-17)15-23(22,12-16)20(28)26-18-6-9-25-13-19(18)27/h1-5,16,18-19,25,27H,6-15H2,(H,26,28)/t16?,18-,19-,21-,22-,23?/m1/s1 |
| InChIKey | QHCZHJFWNYWRQB-WHGXQYHCSA-N |
| XLogP | 2.97 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|