C16H26N2O2 — CID 122566890
N-[(3R,4R)-3-hydroxypiperidin-4-yl]adamantane-1-carboxamide (PubChem CID 122566890) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[(3R,4R)-3-hydroxypiperidin-4-yl]adamantane-1-carboxamide.
| Compound Name | N-[(3R,4R)-3-hydroxypiperidin-4-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 122566890 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-[(3R,4R)-3-hydroxypiperidin-4-yl]adamantane-1-carboxamide |
| SMILES | O=C(N[C@@H]1CCNC[C@H]1O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H26N2O2/c19-14-9-17-2-1-13(14)18-15(20)16-6-10-3-11(7-16)5-12(4-10)8-16/h10-14,17,19H,1-9H2,(H,18,20)/t10?,11?,12?,13-,14-,16?/m1/s1 |
| InChIKey | TZARZZKDVLKMCQ-GQWBEDRXSA-N |
| XLogP | 1.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |