C22H15F3N4O2 — CID 137442130
5-benzyl-9-nitro-2-(trifluoromethyl)-5a,10a-dihydroindolo[2,3-b]quinoxaline (PubChem CID 137442130) has the molecular formula C22H15F3N4O2 and a molecular weight of 424.38 g/mol. Its IUPAC name is 5-benzyl-9-nitro-2-(trifluoromethyl)-5a,10a-dihydroindolo[2,3-b]quinoxaline.
| Compound Name | 5-benzyl-9-nitro-2-(trifluoromethyl)-5a,10a-dihydroindolo[2,3-b]quinoxaline |
|---|---|
| PubChem CID | 137442130 |
| Molecular Formula | C22H15F3N4O2 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 5-benzyl-9-nitro-2-(trifluoromethyl)-5a,10a-dihydroindolo[2,3-b]quinoxaline |
| SMILES | O=[N+]([O-])C1=CC2C(=NC3C2=Nc2cc(C(F)(F)F)ccc2N3Cc2ccccc2)C=C1 |
| InChI | InChI=1S/C22H15F3N4O2/c23-22(24,25)14-6-9-19-18(10-14)26-20-16-11-15(29(30)31)7-8-17(16)27-21(20)28(19)12-13-4-2-1-3-5-13/h1-11,16,21H,12H2 |
| InChIKey | PPYBAGLAAUDVDN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|