C18H11F6N5O3 — CID 121372544
4-benzyl-3-[2-nitro-4-(trifluoromethyl)anilino]-6-(trifluoromethyl)-1,2,4-triazin-5-one (PubChem CID 121372544) has the molecular formula C18H11F6N5O3 and a molecular weight of 459.31 g/mol. Its IUPAC name is 4-benzyl-3-[2-nitro-4-(trifluoromethyl)anilino]-6-(trifluoromethyl)-1,2,4-triazin-5-one.
| Compound Name | 4-benzyl-3-[2-nitro-4-(trifluoromethyl)anilino]-6-(trifluoromethyl)-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 121372544 |
| Molecular Formula | C18H11F6N5O3 |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 4-benzyl-3-[2-nitro-4-(trifluoromethyl)anilino]-6-(trifluoromethyl)-1,2,4-triazin-5-one |
| SMILES | O=c1c(C(F)(F)F)nnc(Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])n1Cc1ccccc1 |
| InChI | InChI=1S/C18H11F6N5O3/c19-17(20,21)11-6-7-12(13(8-11)29(31)32)25-16-27-26-14(18(22,23)24)15(30)28(16)9-10-4-2-1-3-5-10/h1-8H,9H2,(H,25,27) |
| InChIKey | SLQILAMJRKOWHG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|