C20H19F3N6O4 — CID 46554418
N'-(3-ethyl-4-oxoquinazolin-2-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanehydrazide (PubChem CID 46554418) has the molecular formula C20H19F3N6O4 and a molecular weight of 464.40 g/mol. Its IUPAC name is N'-(3-ethyl-4-oxoquinazolin-2-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanehydrazide.
| Compound Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanehydrazide |
|---|---|
| PubChem CID | 46554418 |
| Molecular Formula | C20H19F3N6O4 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanehydrazide |
| SMILES | CCn1c(NNC(=O)CCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])nc2ccccc2c1=O |
| InChI | InChI=1S/C20H19F3N6O4/c1-2-28-18(31)13-5-3-4-6-14(13)25-19(28)27-26-17(30)9-10-24-15-8-7-12(20(21,22)23)11-16(15)29(32)33/h3-8,11,24H,2,9-10H2,1H3,(H,25,27)(H,26,30) |
| InChIKey | NSBJDNVISIVSAQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|